Produktinformation
Name:6,7-Dihydroxyflavone
Marke:Biosynth
Beschreibung:6,7-Dihydroxyflavone is a small molecule flavonoid compound, which is a synthetic product derived to mimic naturally occurring substances. This compound is primarily sourced from the metabolic pathways involved in the biosynthesis of flavonoids, which are naturally found in plants. The mode of action of 6,7-Dihydroxyflavone involves the selective activation of the TrkB receptor, mimicking the action of the brain-derived neurotrophic factor (BDNF). This receptor plays a crucial role in neuronal survival, differentiation, and synaptic plasticity.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:254.24 g/mol
Formel:C15H10O4
Reinheit:Min. 95 Area-%
Farbe/Form:Yellow Powder
InChl:InChI=1S/C15H10O4/c16-11-7-14(9-4-2-1-3-5-9)19-15-8-13(18)12(17)6-10(11)15/h1-8,17-18H
InChI Key:InChIKey=GSAOUZGPXSGVRS-UHFFFAOYSA-N
SMILES:O=c1cc(-c2ccccc2)oc2cc(O)c(O)cc12
Technische Anfrage zu: 6,7-Dihydroxyflavone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.