Produktinformation
Name:3,2'-Dimethoxyflavone
Marke:Biosynth
Beschreibung:3,2'-Dimethoxyflavone is a specialized type of naturally occurring flavone, which is commonly derived from various plant sources such as leaves, stems, and roots. As a flavonoid compound, it is part of a larger class of polyphenolic substances known for their diverse biological activities. The mode of action of 3,2'-Dimethoxyflavone primarily involves its interaction with cellular oxidative pathways, where it exhibits potential antioxidant properties. Additionally, it may act as an enzyme inhibitor, possibly affecting pathways tied to signal transduction and metabolism.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:282.29 g/mol
Formel:C17H14O4
Reinheit:Min. 95%
InChl:InChI=1S/C17H14O4/c1-19-13-9-5-4-8-12(13)16-17(20-2)15(18)11-7-3-6-10-14(11)21-16/h3-10H,1-2H3
InChI Key:InChIKey=SJZIKJCJJAPNQI-UHFFFAOYSA-N
SMILES:COc1ccccc1-c1oc2ccccc2c(=O)c1OC
Technische Anfrage zu: 3,2'-Dimethoxyflavone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.