Produktinformation
Name:Fast Violet B - Dye content 85%
Synonyme:
- N-(4-Amino-5-methoxy-2-methylphenyl)-benzamide
Marke:Biosynth
Beschreibung:Fast Violet B is a diazonium salt that reacts with an amine, such as phosphatase, to release hydrogen. This reaction can be used to measure the activity of phosphatases. The emission of light in the visible range depends on the concentration and pH of the solution. Fast Violet B is soluble in water, alcohol, acetone, ether and chloroform. It has a particle size that ranges from 0.1-0.2 microns in diameter and will not dissolve in most solvents. Fast Violet B can be used to detect zearalenone in animal feed samples using a sample preparation technique called thin layer chromatography (TLC). It has shown clinical utility for determining antibody response in humans by measuring fatty acid synthesis activity during the inflammatory response. Fast Violet B also reacts with hydrogen bonds between nucleotides on DNA molecules and it binds to human mitochondrial DNA because it contains many phosphate groups and several intramolecular hydrogen bonds can form between neighboring
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:256.3 g/mol
Formel:C15H16N2O2
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C15H16N2O2/c1-10-8-12(16)14(19-2)9-13(10)17-15(18)11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18)
InChI Key:InChIKey=VENDXQNWODZJGB-UHFFFAOYSA-N
SMILES:COc1cc(NC(=O)c2ccccc2)c(C)cc1N
Technische Anfrage zu: Fast Violet B - Dye content 85%
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
