Produktinformation
Name:9-Hydroxyfluorene
Kontrolliertes Produkt
Marke:Biosynth
Beschreibung:9-Hydroxyfluorene is a chiral compound that exhibits antimicrobial activity. It has been shown to inhibit the growth of bacteria by interacting with bacterial DNA and preventing RNA synthesis. 9-Hydroxyfluorene binds to bacterial DNA, specifically the nitrogen atoms, which are not present in mammalian DNA. This binding causes the formation of intramolecular hydrogen bonds that inhibits bacterial DNA replication. 9-Hydroxyfluorene also interacts with cellular membranes, inhibiting protein synthesis and cell division. The antimicrobial properties of 9-hydroxyfluorene are due to its ability to bind to bacterial membranes and form hydrogen bonds at specific sites on the membrane surface. This binding alters the membrane's physical properties, leading to cell death.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:182.22 g/mol
Formel:C13H10O
Reinheit:Min. 95%
InChl:InChI=1S/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H
InChI Key:InChIKey=AFMVESZOYKHDBJ-UHFFFAOYSA-N
SMILES:OC1c2ccccc2-c2ccccc21
Technische Anfrage zu: 9-Hydroxyfluorene
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
