Produktinformation
Name:3-Hydroxyflavone
Synonyme:
- Flavon-3-ol 3-Hydroxy-2-phenylchromone
Marke:Biosynth
Beschreibung:3-Hydroxyflavone is a naturally derived flavonoid compound found in various plants. As a member of the flavonoid family, it is synthesized through the phenylpropanoid pathway, starting from phenylalanine or tyrosine in plants. Its unique structure allows it to interact with a range of biological targets through its antioxidant, anti-inflammatory, and enzyme modulation properties. The mode of action primarily involves the scavenging of free radicals and reactive oxygen species, as well as the inhibition of specific enzymes such as cyclooxygenases and lipoxygenases. These actions contribute to its protective effects against oxidative stress and inflammation.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:238.24 g/mol
Formel:C15H10O3
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C15H10O3/c16-13-11-8-4-5-9-12(11)18-15(14(13)17)10-6-2-1-3-7-10/h1-9,17H
InChI Key:InChIKey=HVQAJTFOCKOKIN-UHFFFAOYSA-N
SMILES:O=c1c(O)c(-c2ccccc2)oc2ccccc12
Technische Anfrage zu: 3-Hydroxyflavone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.