Produktinformation
Name:2'-Hydroxy-3-methoxychalcone
Marke:Biosynth
Beschreibung:2'-Hydroxy-3-methoxychalcone is a type of chalcone flavonoid, which is a naturally occurring compound commonly isolated from various plant species. This compound serves as an intermediate in the biosynthesis of flavonoids and is characterized by its distinctive chemical structure featuring both hydroxyl and methoxy functional groups. The mode of action of 2'-Hydroxy-3-methoxychalcone involves its ability to modulate multiple signaling pathways. It exhibits significant antioxidant properties, scavenging reactive oxygen species and thereby reducing oxidative stress. Moreover, it has been shown to possess anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines. Additionally, it demonstrates anticancer activities through the induction of apoptosis and inhibition of cell proliferation.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:254.28 g/mol
Formel:C16H14O3
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C16H14O3/c1-19-13-6-4-5-12(11-13)9-10-16(18)14-7-2-3-8-15(14)17/h2-11,17H,1H3/b10-9+
InChI Key:InChIKey=UKFWQYIIRNXCEQ-MDZDMXLPSA-N
SMILES:COc1cccc(/C=C/C(=O)c2ccccc2O)c1
Technische Anfrage zu: 2'-Hydroxy-3-methoxychalcone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
