

Produktinformation
Name:Isobutyl chloroformate
Marke:Biosynth
Beschreibung:Isobutyl chloroformate is a chemical compound that has intramolecular hydrogen and intermolecular hydrogen bonding. It is a colorless liquid with a boiling point of 182 °C. Isobutyl chloroformate reacts with the carboxylic acid group of caffeic acid to form the corresponding ester, which can be used in the synthesis of caproic acid. Isobutyl chloroformate has been shown to inhibit the growth of breast cancer cells (MDA-MB-231) by binding to integrin receptors on their surface. This drug also has anti-inflammatory properties, which may be due to its ability to inhibit bowel disease such as Crohn's disease and ulcerative colitis by blocking cyclooxygenase enzymes. The reaction mechanism for isobutyl chloroformate involves an S N 2 substitution reaction with formation of an intramolecular hydrogen bond and a disulfide bond. This compound also
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:136.58 g/mol
Formel:C5H9ClO2
Reinheit:Min. 95%
InChl:InChI=1S/C5H9ClO2/c1-4(2)3-8-5(6)7/h4H,3H2,1-2H3
InChI Key:InChIKey=YOETUEMZNOLGDB-UHFFFAOYSA-N
SMILES:CC(C)COC(=O)Cl