Produktinformation
Name:Jaceosidin
Marke:Biosynth
Beschreibung:Jaceosidin is a flavonoid compound, which is derived from various plant species, notably those belonging to the genus Artemisia. This naturally occurring product is known for its diverse pharmacological effects, primarily due to its polyphenolic structure, which allows it to scavenge free radicals and modulate cell signaling pathways. The mode of action of jaceosidin involves inhibition of pro-inflammatory cytokine production and modulation of key signaling pathways such as NF-κB and MAPK. Additionally, it exhibits cytoprotective effects by enhancing the activity of antioxidant enzymes.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:330.29 g/mol
Formel:C17H14O7
Reinheit:Min. 98 Area-%
Farbe/Form:Powder
InChl:InChI=1S/C17H14O7/c1-22-13-5-8(3-4-9(13)18)12-6-10(19)15-14(24-12)7-11(20)17(23-2)16(15)21/h3-7,18,20-21H,1-2H3
InChI Key:InChIKey=GLAAQZFBFGEBPS-UHFFFAOYSA-N
SMILES:COc1cc(-c2cc(=O)c3c(O)c(OC)c(O)cc3o2)ccc1O
Technische Anfrage zu: Jaceosidin
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.