

Produktinformation
Name:2-Methoxyacetophenone
Marke:Biosynth
Beschreibung:2-Methoxyacetophenone is an organic solution that is used in analytical chemistry as a solvent. It has low energy and is a liquid at room temperature. The phase of 2-Methoxyacetophenone can be changed by changing the temperature, and it can be used to separate compounds from each other. 2-Methoxyacetophenone binds to estrogen receptors, which are involved in signal pathways for cancer cell proliferation. 2-Methoxyacetophenone may have potential use as an estrogen receptor modulator for breast cancer treatment. This compound also has been shown to have protective effects against radiation, specifically against gamma rays and x-rays. 2-Methoxyacetophenone reacts with phosphorus pentoxide to form carbonyl groups, which are found in foods such as fried potatoes and french fries.
2-Methoxyacetophenone can also react with hydrochloric acid to form acylation products such as acetyl chloride or acetyl brom
2-Methoxyacetophenone can also react with hydrochloric acid to form acylation products such as acetyl chloride or acetyl brom
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:150.17 g/mol
Formel:C6H5COCH2OCH3
Reinheit:Min. 95%
InChl:InChI=1S/C9H10O2/c1-11-7-9(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3
InChI Key:InChIKey=YRNDGUSDBCARGC-UHFFFAOYSA-N
SMILES:COCC(=O)c1ccccc1