Produktinformation
Name:6-Methoxyflavanone
Marke:Biosynth
Beschreibung:6-Methoxyflavanone is a naturally occurring flavonoid compound, which is typically derived from plant sources, particularly those high in flavonoids such as certain fruits and herbs. The compound is characterized by the presence of a methoxy group, which distinguishes it from other flavanones and may influence its bioactivity and solubility properties. Its mode of action often involves interactions with biological pathways that regulate inflammation, oxidative stress, and cellular metabolism, potentially through mechanisms such as enzyme inhibition or modulation of receptor activity.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:254.28 g/mol
Formel:C16H14O3
Reinheit:Min. 95%
Farbe/Form:Powder
InChl:InChI=1S/C16H14O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-9,16H,10H2,1H3
InChI Key:InChIKey=YURQMHCZHLMHIB-UHFFFAOYSA-N
SMILES:COc1ccc2c(c1)C(=O)CC(c1ccccc1)O2
Technische Anfrage zu: 6-Methoxyflavanone
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.