Produktinformation
Name:Pyridine-3-sulfonic acid
Marke:Biosynth
Beschreibung:Pyridine-3-sulfonic acid is a reactive molecule that can exist in two forms. It reacts with iron oxides to form pyridine-3-sulfonic acid amide and reacts with picolinic acid to form pyridine-3-sulfonic acid phosphoric acid complex. Pyridine 3 sulfonic acid is an intermediate in the synthesis of picolinic acid and is involved in the genetic mechanisms of bacteria. It has been shown to be effective at concentrations of 10 mM or higher when used in tissue culture experiments. The optimum concentration for the reaction varies depending on the reactant and its environment, which is why experimentation should be conducted before using it as a reagent.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:159.16 g/mol
Formel:C5H5NO3S
Reinheit:Min. 95%
InChl:InChI=1S/C5H5NO3S/c7-10(8,9)5-2-1-3-6-4-5/h1-4H,(H,7,8,9)
InChI Key:InChIKey=DVECLMOWYVDJRM-UHFFFAOYSA-N
SMILES:O=S(=O)(O)c1cccnc1
Technische Anfrage zu: Pyridine-3-sulfonic acid
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
