CymitQuimica logo

2-(4-Pyridyl)ethanesulfonic acid

Ref. 3D-FP59745

100g
Ausgelaufen

Ausgelaufenes Produkt. Für Anfragen zu ähnlichen Produkten verwenden Sie bitte unser Anfrageformular oder senden Sie uns eine E-Mail an .

2-(4-Pyridyl)ethanesulfonic acid
Biosynth

    Produktinformation

    Name:2-(4-Pyridyl)ethanesulfonic acid
    Marke:Biosynth
    Beschreibung:2-(4-Pyridyl)ethanesulfonic acid (2-PSES) is a flavin, which is an organic compound that contains a ribose or deoxyribose sugar molecule. 2-PSES is a functional component in the reaction solution of infectious diseases and has been shown to have anti-inflammatory properties. It has been shown to be effective in treating chronic hepatitis B virus infection and may also have potential use in the treatment of other viral infections such as HIV. 2-PSES binds to metal ions, such as technetium, through chelation. It can also bind to chloride ions through coordination geometry, which leads to transfer of the metal ion from water into the cell membrane, causing a change in membrane potential and increased permeability, leading to cell death.
    Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.

    Chemische Eigenschaften

    Molekulargewicht:187.22 g/mol
    Formel:C7H9NO3S
    Reinheit:Min. 95%
    InChl:InChI=1S/C7H9NO3S/c9-12(10,11)6-3-7-1-4-8-5-2-7/h1-2,4-5H,3,6H2,(H,9,10,11)
    InChI Key:InChIKey=RGIIAYDCZSXHGL-UHFFFAOYSA-N
    SMILES:O=S(=O)(O)CCc1ccncc1

    Anfrage zum ausgelaufenen Produkt: 2-(4-Pyridyl)ethanesulfonic acid

    ◻️
    CYMIT QUÍMICA, S.L. wird Ihre Daten behandeln, um auf Ihre Fragen oder Anfragen zu antworten. Sie können auf Ihre Daten zugreifen, sie berichtigen und löschen sowie andere Rechte ausüben, indem Sie die zusätzlichen und detaillierten Informationen zum Datenschutz in unserer Web-Datenschutzerklärung lesen.
    * Obligatorische felder.