Produktinformation
Name:Pachymic acid
Kontrolliertes Produkt
Synonyme:
- 3-Acetyltumulosic acid
Marke:Biosynth
Beschreibung:Pachymic acid is a naturally occurring triterpenoid acid, which is primarily extracted from the sclerotium of Poria cocos, a medicinal fungus widely used in traditional Chinese medicine. It exhibits a range of biological activities attributed to its unique molecular structure. The mode of action of pachymic acid involves the modulation of various signaling pathways, including anti-inflammatory, antioxidant, and apoptotic mechanisms. Additionally, it impacts immune cell regulation and exhibits potential in tumor suppression.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:528.76 g/mol
Formel:C33H52O5
Reinheit:Min. 95%
Farbe/Form:White Powder
InChl:InChI=1S/C33H52O5/c1-19(2)20(3)10-11-22(29(36)37)28-25(35)18-33(9)24-12-13-26-30(5,6)27(38-21(4)34)15-16-31(26,7)23(24)14-17-32(28,33)8/h19,22,25-28,35H,3,10-18H2,1-2,4-9H3,(H,36,37)/t22?,25-,26+,27+,28?,31-,32-,33+/m1/s1
InChI Key:InChIKey=VDYCLYGKCGVBHN-UKMRBMQASA-N
SMILES:C=C(CCC(C(=O)O)C1[C@H](O)C[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(C)=O)C(C)(C)[C@@H]1CC3)C(C)C
Technische Anfrage zu: Pachymic acid
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.