

Produktinformation
Name:Quinapril diketopiperazine
Synonyme:
- (a-S,3S,11aS)-1,3,4,6,11,11a-Hexahydro-3-methyl-1,4-dioxo-a-(2-phenylethyl)-2H-pyrazino[1,2-b]isoquinoline-2-acetic acidPD 109488
Marke:Biosynth
Beschreibung:Quinapril diketopiperazine is an analytical reagent that is used in the determination of the rate of reaction of a chemical substance with quinapril. Quinapril is a dihydropyridine derivative that acts as a vasodilator and antihypertensive drug. The quinapril molecule has a hydroxyl group on its 2-position, which is converted to an amine by the acidic hydrolysis. This amine then reacts with the carboxylic acid to form the diketopiperazine. The reaction rate can be determined by measuring the absorbance at 410 nm using a spectrophotometer and comparing it to a calibration curve.
The chromatographic separation method for determining the concentration of quinapril in solution involves passing an organic solution through a column filled with silica gel or alumina and eluting it with solvents containing different polarities, such as water, methanol, acetone
The chromatographic separation method for determining the concentration of quinapril in solution involves passing an organic solution through a column filled with silica gel or alumina and eluting it with solvents containing different polarities, such as water, methanol, acetone
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:420.5 g/mol
Formel:C25H28N2O4
Reinheit:Min. 95%
InChl:InChI=1S/C25H28N2O4/c1-3-31-25(30)21(14-13-18-9-5-4-6-10-18)27-17(2)23(28)26-16-20-12-8-7-11-19(20)15-22(26)24(27)29/h4-12,17,21-22H,3,13-16H2,1-2H3/t17-,21-,22-/m0/s1
InChI Key:InChIKey=NDDYKENLGBOEPD-HSQYWUDLSA-N
SMILES:CCOC(=O)[C@H](CCc1ccccc1)N1C(=O)[C@@H]2Cc3ccccc3CN2C(=O)[C@@H]1C