Produktinformation
Name:Trityl chloride
Synonyme:
- Triphenylmethyl chloride
- Chlorotriphenylmethane
Marke:Biosynth
Beschreibung:Trityl chloride is an organic compound that has high chemical stability. It is mainly used as a reagent in organic synthesis and polymer chemistry. Trityl chloride reacts with alkanoic acids to form esters by the reaction of the acid chloride with alcohols. Trityl chloride reacts with trifluoroacetic acid to form carboxylic acid chlorides, which are often used as chiral synthons in asymmetric synthesis. The coordination geometry of the trityl ligand is octahedral and it binds to metal cations through three oxygen atoms and two adjacent nitrogen atoms. The polymer compositions can be chiral due to the presence of chiral trityl groups, which can lead to different physical properties such as solubility or melting point.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:278.78 g/mol
Formel:C19H15Cl
Reinheit:(¹H-Nmr) Min. 95 Area-%
Farbe/Form:White Powder
InChl:InChI=1S/C19H15Cl/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H
InChI Key:InChIKey=JBWKIWSBJXDJDT-UHFFFAOYSA-N
SMILES:ClC(c1ccccc1)(c1ccccc1)c1ccccc1
Technische Anfrage zu: Trityl chloride
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
