

Produktinformation
Name:Vinylboronic anhydride pyridine complex
Kontrolliertes Produkt
Marke:Biosynth
Beschreibung:Vinylboronic anhydride pyridine complex is a synthetic molecule that is used as a linker to attach fluoroquinolones to boronic acids, which are used in the synthesis of receptor binding molecules. Studies have shown that this compound has inhibitory activities against inflammation and cancer. Vinylboronic anhydride pyridine complex binds to the malonic acid residues on the surface of proteins and inhibits the release of inflammatory signals. It also inhibits certain enzymes such as phospholipase A2, which play a role in inflammatory diseases. This molecule has been shown to bind with halides and hydroxyl groups, making it useful for attaching other molecules to surfaces or for attaching other molecules together.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:240.67 g/mol
Formel:C11H14B3O3N
Reinheit:Min. 95%
InChl:InChI=1S/C6H9B3O3.C5H5N/c1-4-7-10-8(5-2)12-9(6-3)11-7;1-2-4-6-5-3-1/h4-6H,1-3H2;1-5H
InChI Key:InChIKey=YLHJACXHRQQNQR-UHFFFAOYSA-N
SMILES:C=CB1OB(C=C)OB(C=C)O1.c1ccncc1