Produktinformation
Name:L-chiro-Inositol
Synonyme:
- Levoinositol
Marke:Biosynth
Beschreibung:L-chiro-Inositol is a stereoisomer of inositol, which is a type of sugar alcohol and a critical component of cell membranes. Derived from natural sources such as plants and animals, L-chiro-Inositol plays a significant role in cellular processes through its involvement in the phosphoinositide signaling pathway. This pathway is crucial for mediating various cellular responses to external signals, particularly in the modulation of insulin signaling and glucose metabolism.
By influencing insulin signaling pathways, L-chiro-Inositol contributes to the regulation of glucose uptake and utilization, making it an important compound in studies related to metabolic health, diabetes, and insulin resistance. Researchers also investigate its potential therapeutic applications in managing polycystic ovary syndrome (PCOS) due to its role in improving insulin sensitivity and ovulatory function. Its contribution to cell membrane structure and function further extends its relevance in studies exploring cell signaling, growth, and survival. L-chiro-Inositol serves as a vital compound for scientists examining the intricate interplay between cellular signaling mechanisms and metabolic disorders.
By influencing insulin signaling pathways, L-chiro-Inositol contributes to the regulation of glucose uptake and utilization, making it an important compound in studies related to metabolic health, diabetes, and insulin resistance. Researchers also investigate its potential therapeutic applications in managing polycystic ovary syndrome (PCOS) due to its role in improving insulin sensitivity and ovulatory function. Its contribution to cell membrane structure and function further extends its relevance in studies exploring cell signaling, growth, and survival. L-chiro-Inositol serves as a vital compound for scientists examining the intricate interplay between cellular signaling mechanisms and metabolic disorders.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:180.16 g/mol
Formel:C6H12O6
Reinheit:Min. 95 Area-%
Farbe/Form:Powder
InChl:InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H
InChI Key:InChIKey=CDAISMWEOUEBRE-UHFFFAOYSA-N
SMILES:OC1C(O)C(O)C(O)C(O)C1O
Technische Anfrage zu: L-chiro-Inositol
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
