Produktinformation
1-Ethyl-3-methylimidazolium aminoacetate is a colorless liquid that is soluble in water and organic solvents. It has the chemical formula CH3C(NH2)CH2CH2N(CH3)COO. This compound reacts with many substances, including water and other molecules, at a relatively fast rate. The reaction rate of 1-ethyl-3-methylimidazolium aminoacetate can be measured using techniques such as absorption process, simulations, and viscosity measurements. This compound interacts with others by changing their properties such as viscosity or surface properties. The kinetic constant for this compound can be determined using techniques such as activated enhancement or surface properties.
Chemische Eigenschaften
Technische Anfrage zu: 3D-RFB53774 1-Ethyl-3-methylimidazolium aminoacetate
Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.
