Produktinformation
Name:Anhydronotoptol
Marke:Biosynth
Beschreibung:Anhydronotoptol is a synthetic compound that has been developed through chemical synthesis as a unique bioactive molecule. Its source lies in the modification of natural chemical structures to enhance certain biological properties. The mode of action of Anhydronotoptol involves interaction at a molecular level, where it selectively binds to target receptors, potentially influencing cellular pathways.
Hinweis:Unsere Produkte sind nur für Laborzwecke. Für jede andere Verwendung, bitte melden sie sich bei uns.
Chemische Eigenschaften
Molekulargewicht:336.38 g/mol
Formel:C21H20O4
Reinheit:Min. 95%
InChl:InChI=1S/C21H20O4/c1-14(2)5-4-6-15(3)9-11-24-21-16-7-8-20(22)25-19(16)13-18-17(21)10-12-23-18/h4-5,7-10,12-13H,1,6,11H2,2-3H3/b5-4+,15-9+
InChI Key:InChIKey=SFUVOLKWTCFJSX-YUQKSTFXSA-N
SMILES:C=C(C)/C=C/C/C(C)=C/COc1c2ccoc2cc2oc(=O)ccc12
Technische Anfrage zu: Anhydronotoptol
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern
Bitte verwenden Sie stattdessen den Warenkorb, um ein Angebot oder eine Bestellung anzufordern. Wenn Sie ein Angebot anfordern oder eine Bestellung aufgeben möchten, legen Sie stattdessen die gewünschten Produkte in Ihren Warenkorb und fordern Sie dann ein Angebot oder eine Bestellung an aus dem Warenkorb. Es ist schneller, billiger und Sie können von den verfügbaren Rabatten und anderen Vorteilen profitieren.