CAS 1178974-85-0

Fórmula: C29H36O15

InChI: InChI=1S/C29H36O15/c1-13-22(35)24(37)26(39)28(42-13)41-12-20-23(36)25(38)27(44-21(34)7-4-14-2-5-16(30)18(32)10-14)29(43-20)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13-,20+,22-,23+,24+,25-,26+,27+,28+,29+/m0/s1

Clave InChI: GDGZMMDZJVKXTP-HBIAPIBXSA-N

SMILES: C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OCCC3=CC(=C(C=C3)O)O)OC(=O)/C=C/C4=CC(=C(C=C4)O)O)O)O)O)O)O

Forsythoside H

CAS: 1178974-85-0

Forsythoside H

Fórmula: C₂₉H₃₆O₁₅

Pureza: ≥98%

Peso molecular: 624.59

Ref: 54-BUP00311

Forsythoside H

CAS: 1178974-85-0

Fórmula: C₂₉H₃₆O₁₅

Peso molecular: 624.59

Ref: 7W-GY4390

Forsythoside H

CAS: 1178974-85-0

Fórmula: C₂₉H₃₆O₁₅

Pureza: 95%~99%

Peso molecular: 624.592

Ref: BP-BP2012

Forsythoside H

CAS: 1178974-85-0

Forsythoside H is a nartural product from Forsythia suspense (Thunb.) Vahl.

Fórmula: C₂₉H₃₆O₁₅

Pureza: 98.64% - 99.89%

Forma y color: Solid

Peso molecular: 624.59

Ref: TM-TN1648

Forsythoside H

CAS: 1178974-85-0

Forsythoside H is a phenylethanoid glycoside, which is a secondary metabolite derived from natural plant sources, predominantly found in plants of the Forsythia genus. This compound exerts its effects primarily through its strong anti-inflammatory and antioxidant activities. Its mode of action involves the inhibition of pro-inflammatory cytokines and scavenging of free radicals, thereby reducing oxidative stress and inflammation at a cellular level.

Pureza: Min. 95%

Ref: 3D-FF74344