
CAS: 1246816-73-8
Descripción:The chemical substance with the CAS number 1246816-73-8 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds identified by CAS numbers can vary significantly in their properties, including physical state (solid, liquid, or gas), color, solubility, melting and boiling points, and reactivity. To understand the characteristics of this particular compound, one would typically refer to specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive details on its molecular structure, functional groups, and potential applications. Additionally, information regarding its safety, handling, and environmental impact would be crucial for practical use. If you require specific details about this compound, consulting a chemical database or literature focused on its synthesis and applications would be advisable.
Fórmula:C16H13ClD6N2O
InChI:InChI=1S/C16H19ClN2O/c1-19(2,20)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/i1D3,2D3
Clave InChI:InChIKey=NMEICKDXQPVPKK-WFGJKAKNSA-N
SMILES:O=N(C)(C)CCC(C1=NC=CC=C1)C2=CC=C(Cl)C=C2
- Sinónimos:
- 3-(4-Chlorophenyl)-3-pyridin-2-yl-N,N-bis(trideuteriomethyl)propan-1-amine oxide
Marca | Datos del producto | Pureza | Rango de precios | Entrega estimada |
---|---|---|---|---|
![]() | Chlorpheniramine-d6 N-Oxide Dihydrochloride REF: TR-C424312CAS: | - - - | 1.568,00 € | Mar 27 May 25 |

Chlorpheniramine-d6 N-Oxide Dihydrochloride
Producto controladoRef: TR-C424312
25mg | 1.568,00 € |