CAS 1321924-70-2

Fórmula: C20H24ClFN6O

InChI: InChI=1S/C20H24ClFN6O/c1-11(2)20(3,29)15-10-28(8-7-23-15)19-13(21)9-14(22)17(25-19)16-12-5-4-6-24-18(12)27-26-16/h4-6,9,11,15,23,29H,7-8,10H2,1-3H3,(H,24,26,27)/t15-,20+/m0/s1

Clave InChI: HXWARSZQGAFXJM-MGPUTAFESA-N

SMILES: CC(C)[C@](C)([C@@H]1CN(CCN1)C2=C(C=C(C(=N2)C3=C4C=CC=NC4=NN3)F)Cl)O

(αR,2S)-4-[3-Chloro-5-fluoro-6-(1H-pyrazolo[3,4-b]pyridin-3-yl)-2-pyridinyl]-α-methyl-α-(1-methylethyl)-2-piperazinemethanol

CAS: 1321924-70-2

Fórmula: C₂₀H₂₄ClFN₆O

Pureza: %

Forma y color: Solid

Peso molecular: 418.8956

Ref: IN-DA00A191

VTX-27

CAS: 1321924-70-2

VTX-27

Fórmula: C₂₀H₂₄ClFN₆O

Pureza: ≥98%

Peso molecular: 418.9

Ref: 54-BUP04521

VTX-27

CAS: 1321924-70-2

(R)-2-((S)-4-(3-Chloro-5-fluoro-6-(1H-pyrazolo[3,4-b]pyridin-3-yl)pyridin-2-yl)piperazin-2-yl)-3-methylbutan-2-ol

Fórmula: C₂₀H₂₄ClFN₆O

Pureza: 99+%

Peso molecular: 418.9

Ref: IN-DG01114967

VTX-27

CAS: 1321924-70-2

Ref: 7W-GW0199

VTX-27

CAS: 1321924-70-2

VTX-27 is an innovative bioengineered compound, which is synthesized through a combination of cutting-edge biotechnological and synthetic chemistry techniques. This product acts by modulating specific biological pathways, leveraging its unique molecular structure to interact with targeted receptors or enzymes, thereby altering cellular functions in a highly controlled manner. VTX-27 is primarily used for its potential in therapeutic applications, particularly in the fields of oncology and neurodegenerative disorders. The precise modulation of pathways allows for investigation into novel treatments, offering insights into disease mechanisms and potentially leading to the development of more effective therapeutic strategies with minimized side effects. Scientists are exploring VTX-27 to understand its efficacy and safety profiles, aiming to contribute to the next generation of targeted treatment options.

Fórmula: C₂₀H₂₄ClFN₆O

Pureza: Min. 95%

Peso molecular: 418.9 g/mol

Ref: 3D-WCC92470

VTX-27

CAS: 1321924-70-2

VTX-27 is a selective inhibitor of protein kinase C θ (PKC θ) (Kis: 0.08 nM and 16 nM for PKC θ and PKC δ).

Fórmula: C₂₀H₂₄ClFN₆O

Pureza: 99.84%

Forma y color: Solid

Peso molecular: 418.9

Ref: TM-T13314