CAS 21639-41-8

Fórmula: C7H5ClO3S

InChI: InChI=1S/C7H5ClO3S/c8-12(10,11)7-4-2-1-3-6(7)5-9/h1-5H

Clave InChI: GSUMVXPZWCITFC-UHFFFAOYSA-N

SMILES: C1=CC=C(C(=C1)C=O)S(=O)(=O)Cl

2-Formylbenzene-1-sulfonyl chloride

CAS: 21639-41-8

2-Formylbenzene-1-sulfonyl chloride

Fórmula: C₇H₅ClO₃S

Pureza: 95%

Peso molecular: 204.63

Ref: 54-OR1073204

2-Formylbenzene-1-sulfonyl chloride

CAS: 21639-41-8

Pureza: 95%

Ref: IN-DA00BSBM

2-Formylbenzene-1-sulfonyl chloride

CAS: 21639-41-8

2-Formylbenzene-1-sulfonyl chloride

Fórmula: C₇H₅ClO₃S

Pureza: 95%

Peso molecular: 204.63

Ref: IN-DG01078094

2-Formylbenzene-1-sulfonyl chloride

CAS: 21639-41-8

Pureza: 95%

Peso molecular: 204.6199951

Ref: 10-F666700

2-Formylbenzene-1-sulfonyl chloride

CAS: 21639-41-8

2-Formylbenzene-1-sulfonyl chloride is a molecule that contains sulfur. It is used as an intermediate in the synthesis of other molecules. 2-Formylbenzene-1-sulfonyl chloride has been shown to be able to react with primary amines and chlorides, sulfuryl chloride, or alcohols to form azides, imidazoles, and sulfonates respectively. This reaction was studied using spectroscopic techniques.

Fórmula: C₇H₅ClO₃S

Pureza: Min. 95%

Peso molecular: 204.63 g/mol

Ref: 3D-WAA63941