CAS 457897-73-3

Fórmula: C8H16O5

InChI: InChI=1S/C8H16O5/c1-11-8(10)2-4-12-6-7-13-5-3-9/h9H,2-7H2,1H3

Clave InChI: ZWFWEUBKPURUHJ-UHFFFAOYSA-N

SMILES: COC(=O)CCOCCOCCO

Hydroxy-PEG2-C2-methyl ester

CAS: 457897-73-3

Hydroxy-PEG2-C2-methyl ester

Fórmula: C₈H₁₆O₅

Pureza: 98%

Peso molecular: 192.21

Ref: 54-OR1033129

Hydroxy-PEG2-C2-methyl ester

CAS: 457897-73-3

Hydroxy-PEG2-C2-methyl ester is a polyethylene glycol (PEG)-based linker commonly employed for the synthesis of proteolysis targeting chimeras (PROTACs)[1].

Fórmula: C₈H₁₆O₅

Forma y color: Solid

Peso molecular: 192.21

Ref: TM-T15516

Hydroxy-PEG2-C2-methyl ester

CAS: 457897-73-3

Fórmula: C₈H₁₆O₅

Pureza: 98%

Forma y color: Liquid

Peso molecular: 192.2096

Ref: IN-DA00I8JF

Hydroxy-PEG2-C2-methyl ester

CAS: 457897-73-3

Methyl 3-(2-(2-hydroxyethoxy)ethoxy)propanoate

Fórmula: C₈H₁₆O₅

Pureza: 99%

Peso molecular: 192.21

Ref: IN-DG00846664

methyl 3-[2-(2-hydroxyethoxy)ethoxy]propanoate

CAS: 457897-73-3

Pureza: 98%

Peso molecular: 192.2109985

Ref: 10-F863891

Methyl 3-(2-(2-Hydroxyethoxy)ethoxy)propanoate

Producto controlado

CAS: 457897-73-3

Fórmula: C₈H₁₆O₅

Forma y color: Neat

Peso molecular: 192.21

Ref: TR-M001100