CAS 73731-86-9

Fórmula: C16H18O3

InChI: InChI=1S/C16H18O3/c1-19-16-11-15(18)10-7-13(16)4-2-3-12-5-8-14(17)9-6-12/h5-11,17-18H,2-4H2,1H3

Clave InChI: CJJJQWAYMRTLJT-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)O)CCCC2=CC=C(C=C2)O

Broussonin B

CAS: 73731-86-9

Fórmula: C₁₆H₁₈O₃

Pureza: 98.0%

Peso molecular: 258.3123

Ref: IN-DA00FEP0

Broussonin B

CAS: 73731-86-9

New phytoalexins Broussonins A/B from diseased paper mulberry; Broussonin B promotes neurite growth, inhibits protease and fat accumulation.

Fórmula: C₁₆H₁₈O₃

Pureza: 98%

Forma y color: Solid

Peso molecular: 258.31

Ref: TM-TN5655

Broussonin B

CAS: 73731-86-9

Fórmula: C₁₆H₁₈O₃

Pureza: 95%~99%

Forma y color: Powder

Peso molecular: 258.317

Ref: BP-SBP02290

Broussonin B

CAS: 73731-86-9

Broussonin B is a natural product, which is a flavonoid isolated from the Broussonetia genus. It is derived from various plant sources, primarily the Broussonetia papyrifera, known for its rich secondary metabolite content. The mode of action of Broussonin B involves the induction of apoptosis through the modulation of several signaling pathways. This compound has shown a significant ability to interfere with cell cycle progression, ultimately leading to programmed cell death in various cancer cell lines.

Fórmula: C₁₆H₁₈O₃

Pureza: Min. 95%

Peso molecular: 258.31 g/mol

Ref: 3D-YCA73186