Información del producto
Nombre:2-Amino-5-methylpyridine
Marca:Biosynth
Descripción:2-Amino-5-methylpyridine is a chemical compound that belongs to the group of methyl ketones. It has a nitrogen atom and an oxygen atom in its structure, which allows it to form hydrogen bonds with other molecules. 2-Amino-5-methylpyridine can be obtained by reacting hydrochloric acid and xanthone in the presence of a base. The compound is highly reactive and has been shown to have antiinflammatory properties. This can be attributed to its ability to inhibit prostaglandin synthesis. 2-Amino-5-methylpyridine also has fluorescence properties that are sensitive to pH changes and can be used as a probe for metal ions.
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
2-Amino-5-methylpyridine is an organic compound that contains a methyl group, two nitrogen atoms, and one oxygen atom in its chemical structure. This molecule can form hydrogen bonds with other molecules due to its nitrogen atoms and oxygen atom,
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:108.14 g/mol
Fórmula:C6H8N2
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C6H8N2/c1-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)
Clave InChI:InChIKey=CMBSSVKZOPZBKW-UHFFFAOYSA-N
SMILES:Cc1ccc(N)nc1
Consulta técnica sobre: 2-Amino-5-methylpyridine
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.
