

Información del producto
Nombre:2-Acetylcyclopentanone
Marca:Biosynth
Descripción:2-Acetylcyclopentanone is a chemical compound that has been studied for its potential use as an anti-infective agent. This compound has shown to inhibit the growth of bacteria and fungi, including Candida albicans, Staphylococcus aureus, and Aspergillus fumigatus. 2-Acetylcyclopentanone also inhibits the production of reactive oxygen species by mitochondria in rat striatal cells. The mechanism of action is not yet known but may involve the formation of an acid complex with metal hydroxides, which can be found in fatty acids and radiation particles. 2-Acetylcyclopentanone is not active against Gram-positive or Gram-negative bacteria because it does not cross the cell membrane. It is also poorly absorbed into the bloodstream because it is rapidly converted to acetolactate within cells.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:126.15 g/mol
Fórmula:C7H10O2
Pureza:Min. 95%
InChI:InChI=1S/C7H10O2/c1-5(8)6-3-2-4-7(6)9/h6H,2-4H2,1H3
Clave InChI:InChIKey=OSWDNIFICGLKEE-UHFFFAOYSA-N
SMILES:CC(=O)C1CCCC1=O