

Información del producto
Nombre:4-Benzylaniline
Marca:Biosynth
Descripción:4-Benzylaniline is an amine compound that can be used as a precursor to the synthesis of diazo compounds. 4-Benzylaniline can be synthesized by the reaction of benzaldehyde and ammonia chloride. Alternatively, it can be made by nitration of aniline in the presence of hydrochloric acid. This compound is soluble in water and methanol but insoluble in ether. It is also soluble in concentrated hydrochloric acid, but not in dilute hydrochloric acid. The solubility of this compound increases with increasing temperature and decreasing pH. The melting point is -14 degrees Celsius, and the boiling point is 190 degrees Celsius at a pressure of one atmosphere. 4-Benzylaniline has a molecular weight of 138 g/mol.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:183.25 g/mol
Fórmula:C13H13N
Pureza:Min. 95%
InChI:InChI=1S/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2
Clave InChI:InChIKey=WDTRNCFZFQIWLM-UHFFFAOYSA-N
SMILES:Nc1ccc(Cc2ccccc2)cc1