

Información del producto
Nombre:Butyl Acetoacetate
Sinónimos:
- Acetoacetic Acid Butyl Ester
Marca:Biosynth
Descripción:Butyl Acetoacetate (BA) is an acceptor in the reaction of aldehydes with electron-deficient alkanes. This reaction is catalyzed by a metal complex and proceeds through an initial hydrogenation to form the corresponding alkylborane, followed by a dehydrogenation to form the final product. The reaction rate increases with increasing temperature and particle size. The optical system can be adjusted to produce particles of different diameters, which can lead to changes in reactivity and anti-reflection properties. The average particle diameter is around 5 microns. BA has been used as a substrate film for influenza virus, which leads to reactive molecules that are active methylene groups, carbonyl groups, or functional groups. These reactive molecules are linear polymers that have chains of up to 100 units long.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:158.19 g/mol
Fórmula:C8H14O3
Pureza:Min. 95%
InChI:InChI=1S/C8H14O3/c1-3-4-5-11-8(10)6-7(2)9/h3-6H2,1-2H3
Clave InChI:InChIKey=REIYHFWZISXFKU-UHFFFAOYSA-N
SMILES:CCCCOC(=O)CC(C)=O