Información del producto
Nombre:5-Bromo-2-methoxytoluene
Sinónimos:
- 4-Bromo-1-methoxy-2-methylbenzene
Marca:Biosynth
Descripción:5-Bromo-2-methoxytoluene is a bromoarene that reacts to form aziridines and phosphotungstic acid. It is used in the synthesis of polyaromatic compounds with steric interactions. 5-Bromo-2-methoxytoluene is also a functional group that can be used as an allosteric modulator. This compound also has stereoisomers that are chiral, meaning they have different structures despite being mirror images of each other. The carbonyl group on the 5-bromo compound is polar, which means it has a charge. The hydrogen bonds between this compound and other molecules are nonpolar, which means they do not have a charge and are more likely to form in a nonpolar solvent.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:201.06 g/mol
Fórmula:C8H9BrO
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3
Clave InChI:InChIKey=UDLRGQOHGYWLCS-UHFFFAOYSA-N
SMILES:COc1ccc(Br)cc1C
Consulta técnica sobre: 5-Bromo-2-methoxytoluene
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.