Información del producto
Nombre:5-Chloro-2-pentanone
Marca:Biosynth
Descripción:5-Chloro-2-pentanone is a reactive, unsaturated ketone. It is a colorless liquid with a pungent odor. 5-Chloro-2-pentanone can be used in the synthesis of other organic compounds, such as covid-19 pandemic. The reaction of carbonyl groups with hydrogen chloride and chlorine atom to form hydrochloric acid and chlorocarbons is an example of a reaction that 5-chloro-2-pentanone can take part in. When 5-chloro-2-pentanone reacts with hydrogen chloride (HCl) and chlorine atom (Cl), the reaction products are hydrochloric acid (HCl) and chlorocarbons. This process is called nucleophilic attack and proceeds as follows: 5CH=C(CH)COH + HCl + Cl → CH=C(CH)COCl + H+ + Cl 5CH=C
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:120.58 g/mol
Fórmula:C5H9ClO
Pureza:Min. 95%
Color/Forma:Clear Liquid
InChI:InChI=1S/C5H9ClO/c1-5(7)3-2-4-6/h2-4H2,1H3
Clave InChI:InChIKey=XVRIEWDDMODMGA-UHFFFAOYSA-N
SMILES:CC(=O)CCCCl
Consulta técnica sobre: 5-Chloro-2-pentanone
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.