

Información del producto
Nombre:(S)-(-)-2-Chloropropionic acid
Sinónimos:
- L-(a)-Chloropropionic acid(2S)-2-Chloropropanoic acid
Marca:Biosynth
Descripción:(S)-(-)-2-Chloropropionic acid is a biologically active molecule that can be used for the treatment of various diseases. It inhibits the production of voltage-dependent calcium channels, which are involved in the release of neurotransmitters and in locomotor activity. The inhibition of these channels leads to an increase in intracellular calcium levels and necrotic cell death. (S)-(-)-2-Chloropropionic acid has been shown to inhibit glutamate receptors, which are involved in the transmission of pain signals to the brain. This drug also binds to acid complexes, inhibiting their effects on cells and potentially leading to cancer cell death.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:108.52 g/mol
Fórmula:C3H5ClO2
Pureza:Min. 95%
Color/Forma:Colourless To Pale Yellow Liquid