Información del producto
Nombre:3-Chlorobenzyl chloride
Marca:Biosynth
Descripción:3-Chlorobenzyl chloride is an aryl halide that binds to the p. aeruginosa group in the cell membrane and inhibits bacterial growth by inhibiting the synthesis of essential cell components such as proteins, nucleic acids, and lipids. 3-Chlorobenzyl chloride binds to inhibitory molecules on the p. aeruginosa cell surface by covalent bonds or ionic interactions, which prevents these molecules from interacting with other cells. This inhibits the production of functional groups such as chloride ions and cross-coupling reactions. 3-Chlorobenzyl chloride has been shown to have chemical properties that prevent it from being metabolized by microorganisms, which may be due to its resistance to hydrolysis or oxidative metabolism.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:161.03 g/mol
Fórmula:C7H6Cl2
Pureza:Min. 95%
Color/Forma:Colorless Clear Liquid
InChI:InChI=1S/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2
Clave InChI:InChIKey=DDGRAFHHXYIQQR-UHFFFAOYSA-N
SMILES:ClCc1cccc(Cl)c1
Consulta técnica sobre: 3-Chlorobenzyl chloride
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.
