Información del producto
Nombre:Cyfluthrin
Marca:Biosynth
Descripción:Cyfluthrin is a pyrethroid insecticide that inhibits the activity of various enzymes, including those involved in the synthesis of proteins and nucleic acids. Cyfluthrin has been shown to synergize with other insecticides, such as carbamate or organophosphate compounds. It also has a sublethal effect on insects at low doses. Cyfluthrin is not genotoxic, but can cause biochemical and metabolic disorders in vertebrates. The toxicity of cyfluthrin can be determined by measuring its fluorescence spectrum using fluorescence spectrometry. The absorption spectrum and fluorescence emission spectra are then used to determine the chemical structure of cyfluthrin. Sodium citrate is used as an analytical reagent for cyfluthrin because it has been shown to increase the solubility of this compound in water.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:434.29 g/mol
Fórmula:C22H18Cl2FNO3
Pureza:Min. 95%
SMILES:CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1ccc(F)c(Oc2ccccc2)c1