
2,3-Difluoro pyridine
CAS:
Ref. 3D-FD16119

Información del producto
Nombre:2,3-Difluoro pyridine
Marca:Biosynth
Descripción:2,3-Difluoro pyridine is an organic compound with the chemical formula C6H3F2N. It is a colorless liquid that has a strong odor and a boiling point of 147°C. 2,3-Difluoro pyridine has antibacterial properties and can be used to treat bacterial infections by inhibiting the synthesis of proteins in bacterial cells. This inhibition prevents the formation of new cell walls, which leads to cell death. 2,3-Difluoro pyridine is also used as an intermediate in organic chemistry reactions involving hydrogen fluoride. The transport properties of this compound are low due to its high melting point and low solubility in water. There are three different polymorphs for 2,3-difluoropyridine: form II, form III and form IV, with form II being the most common. Form II has a trigonal planar molecular geometry, whereas forms III and IV have tetragonal
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:115.08 g/mol
Fórmula:C5H3F2N
Pureza:Min. 95%
Color/Forma:Clear Liquid
InChI:InChI=1S/C5H3F2N/c6-4-2-1-3-8-5(4)7/h1-3H
Clave InChI:InChIKey=OGVLEPMNNPZAPS-UHFFFAOYSA-N
SMILES:Fc1cccnc1F