Información del producto
Nombre:2,3-Dimethyl-1-butene
Marca:Biosynth
Descripción:2,3-Dimethyl-1-butene is a hydrocarbon that is reactive with chlorine and forms an alkyl chloride. It has been used as a homogeneous catalyst for the synthesis of acid from inorganic acids and sulfonic acids. The reaction mechanism is not well understood, but it may be due to the formation of a coordination complex between the metal hydroxide and 2,3-dimethyl-1-butene. 2,3-Dimethyl-1-butene reacts with acid to form dimethyl fumarate.
2,3-Dimethyl-1-butene can also react with water to form an inorganic acid or a sulfonic acid. The equilibrium constant is dependent on the concentration of water in solution.
2,3-Dimethyl-1-butene can also react with water to form an inorganic acid or a sulfonic acid. The equilibrium constant is dependent on the concentration of water in solution.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:84.16 g/mol
Fórmula:C6H12
Pureza:Min. 95%
InChI:InChI=1S/C6H12/c1-5(2)6(3)4/h6H,1H2,2-4H3
Clave InChI:InChIKey=OWWIWYDDISJUMY-UHFFFAOYSA-N
SMILES:C=C(C)C(C)C