Información del producto
Nombre:4,5-Dichlorophthalic acid
Sinónimos:
- 4,5-Dichloro-2-carboxybenzoic acid
Marca:Biosynth
Descripción:4,5-Dichlorophthalic acid is a dibasic acid that can be used to produce polycarboxylic acids and phthalimides. It is a colorless solid that reacts with water in the presence of oxygen or other oxidizing agents to form hydrogen chloride. The reaction yields of 4,5-dichlorophthalic acid are dependent on the concentration of proton donor. The optical properties of 4,5-dichlorophthalic acid are determined by its intramolecular hydrogen bond and its substructures. The molecule has an acylation reaction with diisopropylamine to form 4,5-dichlorophthaloyl chloride. This product also undergoes dehydration reactions to produce hexamethylenetetramine and phthalimides. Hydrogen bonds between 4,5-dichlorophthalic acid and water molecules are broken during these reactions, which may lead to the formation
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:235.02 g/mol
Fórmula:C8H4Cl2O4
Pureza:Min. 95%
InChI:InChI=1S/C8H4Cl2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14)
Clave InChI:InChIKey=FDOQKGWUMUEJLX-UHFFFAOYSA-N
SMILES:O=C(O)c1cc(Cl)c(Cl)cc1C(=O)O