Información del producto
Nombre:4,4'-Dimethoxybenzophenone
Marca:Biosynth
Descripción:4,4'-Dimethoxybenzophenone is a process optimization agent that can be used to measure the concentration of basic proteins in human serum. It is also used as a chemical intermediate in the production of polymers. In this application, 4,4'-dimethoxybenzophenone undergoes an irreversible oxidation reaction with trifluoroacetic acid to form 4-methoxybenzoic acid and hydrogen peroxide. The linear model for this reaction has been shown to be:
The rate of the reaction depends on the concentration of homogeneous catalysts, such as metal surfaces or hydrogen bonds.
The rate of the reaction depends on the concentration of homogeneous catalysts, such as metal surfaces or hydrogen bonds.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:242.27 g/mol
Fórmula:C15H14O3
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C15H14O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10H,1-2H3
Clave InChI:InChIKey=RFVHVYKVRGKLNK-UHFFFAOYSA-N
SMILES:COc1ccc(C(=O)c2ccc(OC)cc2)cc1
Consulta técnica sobre: 4,4'-Dimethoxybenzophenone
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.