Información del producto
Nombre:3,2'-Dimethoxyflavone
Marca:Biosynth
Descripción:3,2'-Dimethoxyflavone is a specialized type of naturally occurring flavone, which is commonly derived from various plant sources such as leaves, stems, and roots. As a flavonoid compound, it is part of a larger class of polyphenolic substances known for their diverse biological activities. The mode of action of 3,2'-Dimethoxyflavone primarily involves its interaction with cellular oxidative pathways, where it exhibits potential antioxidant properties. Additionally, it may act as an enzyme inhibitor, possibly affecting pathways tied to signal transduction and metabolism.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:282.29 g/mol
Fórmula:C17H14O4
Pureza:Min. 95%
InChI:InChI=1S/C17H14O4/c1-19-13-9-5-4-8-12(13)16-17(20-2)15(18)11-7-3-6-10-14(11)21-16/h3-10H,1-2H3
Clave InChI:InChIKey=SJZIKJCJJAPNQI-UHFFFAOYSA-N
SMILES:COc1ccccc1-c1oc2ccccc2c(=O)c1OC
Consulta técnica sobre: 3,2'-Dimethoxyflavone
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.