

Información del producto
Nombre:Ethyl 3-chloropropionate
Marca:Biosynth
Descripción:Ethyl 3-chloropropionate is a liquid with a boiling point of 65°C. It is used in the reaction between nitrobenzene and hydrochloric acid to produce an intermediate compound, which is then reacted with chloroethane. This process results in the formation of ethyl 3-chloropropionate, which can be used as an antifungal agent or a precursor for other compounds. The reaction mechanism starts with the addition of chloride to nitrobenzene, forming a nitro chloride that undergoes substitution reactions with hydrochloric acid. This leads to the formation of an intermediate compound that reacts with chloroethane to produce ethyl 3-chloropropionate.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:136.58 g/mol
Fórmula:C5H9ClO2
Pureza:Min. 95%
Color/Forma:Clear Liquid
InChI:InChI=1S/C5H9ClO2/c1-2-8-5(7)3-4-6/h2-4H2,1H3
Clave InChI:InChIKey=ZCLGVXACCAZJOX-UHFFFAOYSA-N
SMILES:CCOC(=O)CCCl