

Información del producto
Nombre:Ethyl 6-chloronicotinate
Sinónimos:
- 6-Chloronicotinic acid ethyl ester
Marca:Biosynth
Descripción:Ethyl 6-chloronicotinate is a synthetic chemical that acts as an acetylcholinesterase inhibitor. It binds to the receptor for chemokine, which is a type of protein that attracts cells such as monocytes and T-cells. This binding prevents the production of inflammatory cytokines, leading to the inhibition of inflammation in the body. The functional theory has been used to explain its ability to bind to this receptor. The functional theory states that if two molecules have similar shapes, they will be able to interact with each other more easily than with molecules of different shapes. Ethyl 6-chloronicotinate is also synthesized from an organometallic compound, which can be a crystalline solid or liquid at room temperature. The carboxylate group in this molecule reacts with sulfoxide groups on collagen and produces acetylcholine, which is then converted into ethyl 6-chloronicotinate by the enzyme acetylcholinesterase. This chemical
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:185.61 g/mol
Fórmula:C8H8ClNO2
Pureza:Min. 95%
InChI:InChI=1S/C8H8ClNO2/c1-2-12-8(11)6-3-4-7(9)10-5-6/h3-5H,2H2,1H3
Clave InChI:InChIKey=ILDJJTQWIZLGPO-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc(Cl)nc1