
4-Ethoxybenzyl alcohol
CAS:
Ref. 3D-FE70748

Información del producto
Nombre:4-Ethoxybenzyl alcohol
Marca:Biosynth
Descripción:4-Ethoxybenzyl alcohol is a reactive compound that can be photoexcited. It has been shown to have a cavity and is able to absorb light of wavelengths between 250 nm and 500 nm. 4-Ethoxybenzyl alcohol reacts with various compounds, such as aldehydes, to form new compounds. It has been shown that the reaction system can be used for high-throughput analysis, which may lead to the discovery of new drugs. It also has been found that 4-ethoxybenzyl alcohol can react with sulfates in an organic solvent to produce sulfonates. This reaction system has potential for use in the production of new drugs or other chemical products.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:152.19 g/mol
Fórmula:C9H12O2
Pureza:Min. 95%
Color/Forma:Colorless Powder
InChI:InChI=1S/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3
Clave InChI:InChIKey=UKFLLQIRBABMKF-UHFFFAOYSA-N
SMILES:CCOc1ccc(CO)cc1