Información del producto
Nombre:Fmoc-glycinol
Sinónimos:
- Fmoc-Gly-OL
Marca:Biosynth
Descripción:Fmoc-glycinol is a synthetase that is used to synthesize glycinol conjugates. It binds to the receptor on Gram-positive bacteria and blocks the synthesis of bacterial cell wall, leading to cell death. Fmoc-glycinol has been shown to have high binding constants with amines and an acyl chain, which allows it to bind with antigen. Fmoc-glycinol also has strong nucleophilic properties that allow it to react with chloride ions in water and other polar solvents. This reaction mechanism leads to the formation of a new bond between two molecules, which is called a glycinol linkage.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:283.32 g/mol
Fórmula:C17H17NO3
Pureza:Min. 95%
Color/Forma:White Powder
InChI:InChI=1S/C17H17NO3/c19-10-9-18-17(20)21-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16,19H,9-11H2,(H,18,20)
Clave InChI:InChIKey=XLIFWDZVNRWYKV-UHFFFAOYSA-N
SMILES:O=C(NCCO)OCC1c2ccccc2-c2ccccc21
Consulta técnica sobre: Fmoc-glycinol
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.