Información del producto
Nombre:2-Fluorophenylacetic acid
Marca:Biosynth
Descripción:2-Fluorophenylacetic acid (2FPAA) is an organic compound that has been used as a reagent in analytical chemistry and organic synthesis. It is the methyl ester of 2-fluorophenol, which is synthesized by methylation of phenol with methanol and hydrochloric acid. The compound has two isomers, 2-fluoroanisole and 2-fluoroanisic acid. 2FPAA can be prepared by reacting trifluoroacetic acid with chloroform, or by reacting hydrochloric acid with phenol. This compound has been studied for its biological effects. It was found to have antiplatelet activity similar to prasugrel (a drug used to prevent blood clots), but less potent than other benzoxazinones such as fluoxetine.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:154.14 g/mol
Fórmula:C8H7FO2
Pureza:Min. 95%
InChI:InChI=1S/C8H7FO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11)
Clave InChI:InChIKey=RPTRFSADOICSSK-UHFFFAOYSA-N
SMILES:O=C(O)Cc1ccccc1F