Información del producto
Nombre:Fast Violet B - Dye content 85%
Sinónimos:
- N-(4-Amino-5-methoxy-2-methylphenyl)-benzamide
Marca:Biosynth
Descripción:Fast Violet B is a diazonium salt that reacts with an amine, such as phosphatase, to release hydrogen. This reaction can be used to measure the activity of phosphatases. The emission of light in the visible range depends on the concentration and pH of the solution. Fast Violet B is soluble in water, alcohol, acetone, ether and chloroform. It has a particle size that ranges from 0.1-0.2 microns in diameter and will not dissolve in most solvents. Fast Violet B can be used to detect zearalenone in animal feed samples using a sample preparation technique called thin layer chromatography (TLC). It has shown clinical utility for determining antibody response in humans by measuring fatty acid synthesis activity during the inflammatory response. Fast Violet B also reacts with hydrogen bonds between nucleotides on DNA molecules and it binds to human mitochondrial DNA because it contains many phosphate groups and several intramolecular hydrogen bonds can form between neighboring
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:256.3 g/mol
Fórmula:C15H16N2O2
Pureza:Min. 95%
Color/Forma:Powder
InChI:InChI=1S/C15H16N2O2/c1-10-8-12(16)14(19-2)9-13(10)17-15(18)11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18)
Clave InChI:InChIKey=VENDXQNWODZJGB-UHFFFAOYSA-N
SMILES:COc1cc(NC(=O)c2ccccc2)c(C)cc1N
Consulta técnica sobre: Fast Violet B - Dye content 85%
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.
