Información del producto
Nombre:Homophthalic acid
Marca:Biosynth
Descripción:Homophthalic acid is a non-toxic chemical compound that is used in the synthesis of various organic molecules. Homophthalic acid is synthesized by the Suzuki coupling reaction between malonic acid and aniline or benzyl chloride. Homophthalic acid can also be obtained from the reaction of hydrochloric acid and trifluoroacetic acid with a fatty acid. The asymmetric synthesis of homophthalic acid involves two different starting materials, one containing a hydroxyl group and the other containing a carboxylate group. The hydrogen bonding interactions between these groups are necessary for this synthesis to take place. Homophthalic acids have been found to bind to receptors in cell membranes and act as agonists, causing changes in receptor-mediated signal transduction pathways.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:180.16 g/mol
Fórmula:C9H8O4
Pureza:Min. 95%
InChI:InChI=1S/C9H8O4/c10-8(11)5-6-3-1-2-4-7(6)9(12)13/h1-4H,5H2,(H,10,11)(H,12,13)
Clave InChI:InChIKey=ZHQLTKAVLJKSKR-UHFFFAOYSA-N
SMILES:O=C(O)Cc1ccccc1C(=O)O