

Información del producto
Nombre:3-Hydroxy ropivacaine
Sinónimos:
- (2S)-N-(3-Hydroxy-2,6-dimethylphenyl)-1-propyl-2-piperidinecarboxamide
Marca:Biosynth
Descripción:3-Hydroxy ropivacaine is a local anesthetic that has been studied for its effects on the central nervous system and peripheral nerves. It is a prodrug that is metabolized to 3-hydroxypivalic acid (3HA) in the blood stream. 3-Hydroxy ropivacaine inhibits the metabolism of other drugs, such as phenytoin, which are metabolized by cytochrome P450, leading to increased concentrations of these drugs in plasma. 3-Hydroxy ropivacaine also inhibits the metabolism of other drugs, such as phenytoin, which are metabolized by cytochrome P450, leading to increased concentrations of these drugs in plasma. The inhibition study used reconstituted human plasma samples and chromatographic methods with reaction monitoring. The inhibition was observed at all three isozymes: CYP2C9, CYP2C19 and CYP3A4.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:290.4 g/mol
Fórmula:C17H26N2O2
Pureza:Min. 95%
InChI:InChI=1S/C17H26N2O2/c1-4-10-19-11-6-5-7-14(19)17(21)18-16-12(2)8-9-15(20)13(16)3/h8-9,14,20H,4-7,10-11H2,1-3H3,(H,18,21)
Clave InChI:InChIKey=IXOVDWXTIIYVOJ-UHFFFAOYSA-N
SMILES:CCCN1CCCCC1C(=O)Nc1c(C)ccc(O)c1C