Información del producto
Nombre:9-Hydroxyfluorene
Producto controlado
Marca:Biosynth
Descripción:9-Hydroxyfluorene is a chiral compound that exhibits antimicrobial activity. It has been shown to inhibit the growth of bacteria by interacting with bacterial DNA and preventing RNA synthesis. 9-Hydroxyfluorene binds to bacterial DNA, specifically the nitrogen atoms, which are not present in mammalian DNA. This binding causes the formation of intramolecular hydrogen bonds that inhibits bacterial DNA replication. 9-Hydroxyfluorene also interacts with cellular membranes, inhibiting protein synthesis and cell division. The antimicrobial properties of 9-hydroxyfluorene are due to its ability to bind to bacterial membranes and form hydrogen bonds at specific sites on the membrane surface. This binding alters the membrane's physical properties, leading to cell death.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:182.22 g/mol
Fórmula:C13H10O
Pureza:Min. 95%
InChI:InChI=1S/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H
Clave InChI:InChIKey=AFMVESZOYKHDBJ-UHFFFAOYSA-N
SMILES:OC1c2ccccc2-c2ccccc21
Consulta técnica sobre: 9-Hydroxyfluorene
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.
