Información del producto
Nombre:5-Hydroxy-7-methoxyisoflavone
Marca:Biosynth
Descripción:5-Hydroxy-7-methoxyisoflavone is an isoflavone compound, a type of naturally occurring organic substance usually derived from plant sources such as soybeans and other legumes. These compounds are known for their significant role in the plant kingdom, often contributing to the plant's resistance against pathogens and environmental stresses. The mode of action of 5-Hydroxy-7-methoxyisoflavone involves its potential antioxidant properties, where it may neutralize free radicals, thereby reducing oxidative stress and cellular damage. This activity arises primarily from its chemical structure, enabling it to donate electrons to unstable molecules.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:268.26 g/mol
Fórmula:C16H12O4
Pureza:Min. 95%
InChI:InChI=1S/C16H12O4/c1-19-11-7-13(17)15-14(8-11)20-9-12(16(15)18)10-5-3-2-4-6-10/h2-9,17H,1H3
Clave InChI:InChIKey=OENYLOITAIRUMV-UHFFFAOYSA-N
SMILES:COc1cc(O)c2c(=O)c(-c3ccccc3)coc2c1
Consulta técnica sobre: 5-Hydroxy-7-methoxyisoflavone
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.