Información del producto
Nombre:4'-Hydroxyflavonol
Sinónimos:
- 3,4'-Dihydroxyflavone
Marca:Biosynth
Descripción:4'-Hydroxyflavonol is a flavonoid compound, which is a naturally occurring phenolic structure commonly found in various plants. It is derived from sources such as fruits, vegetables, and certain medicinal herbs known for their rich polyphenolic content. The mode of action of 4'-Hydroxyflavonol primarily involves its antioxidant properties. It is capable of scavenging free radicals and chelating metal ions, thus protecting cells from oxidative stress and potential damage. Additionally, it may influence signaling pathways related to inflammation and immune response.
Aviso:Nuestros productos están destinados únicamente para uso en laboratorio. Para cualquier otro uso, por favor contáctenos.
Propiedades químicas
Peso molecular:254.24 g/mol
Fórmula:C15H10O4
Color/Forma:Slightly Yellow Powder
InChI:InChI=1S/C15H10O4/c16-10-7-5-9(6-8-10)15-14(18)13(17)11-3-1-2-4-12(11)19-15/h1-8,16,18H
Clave InChI:InChIKey=GPGOCTLAUAHUQO-UHFFFAOYSA-N
SMILES:O=c1c(O)c(-c2ccc(O)cc2)oc2ccccc12
Consulta técnica sobre: 4'-Hydroxyflavonol
Use el carrito para solicitar presupuestos o pedidos
Si desea solicitar un presupuesto o realizar un pedido, por favor añada los productos deseados a su carrito y solicite un presupuesto o pedido desde el carrito. Es más rápido, más barato, y podrá beneficiarse de los descuentos y las ventajas disponibles.